EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O14S2 |
| Net Charge | 0 |
| Average Mass | 464.338 |
| Monoisotopic Mass | 463.93555 |
| SMILES | O=C1c2c(O)c(O)c(S(=O)(=O)O)c(O)c2C(=O)c2c(O)c(O)c(S(=O)(=O)O)c(O)c21 |
| InChI | InChI=1S/C14H8O14S2/c15-5-1-3(9(19)13(29(23,24)25)11(21)7(1)17)6(16)2-4(5)10(20)14(30(26,27)28)12(22)8(2)18/h17-22H,(H,23,24,25)(H,26,27,28) |
| InChIKey | PSJDSNYTNOHIER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonic acid (CHEBI:87372) has role histological dye (CHEBI:77178) |
| 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonic acid (CHEBI:87372) is a hexahydroxyanthraquinone (CHEBI:37499) |
| 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonic acid (CHEBI:87372) is a organosulfonic acid (CHEBI:33551) |
| 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonic acid (CHEBI:87372) is conjugate acid of 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonate (CHEBI:87371) |
| Incoming Relation(s) |
| 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonate (CHEBI:87371) is conjugate base of 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonic acid (CHEBI:87372) |
| IUPAC Name |
|---|
| 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonic acid |
| Synonym | Source |
|---|---|
| alizarin cyanin BBS free acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3522175 | Reaxys |