EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H6O14S2.2Na |
| Net Charge | 0 |
| Average Mass | 508.302 |
| Monoisotopic Mass | 507.89944 |
| SMILES | O=C1c2c(O)c(O)c(S(=O)(=O)[O-])c(O)c2C(=O)c2c(O)c(O)c(S(=O)(=O)[O-])c(O)c21.[Na+].[Na+] |
| InChI | InChI=1S/C14H8O14S2.2Na/c15-5-1-3(9(19)13(29(23,24)25)11(21)7(1)17)6(16)2-4(5)10(20)14(30(26,27)28)12(22)8(2)18;;/h17-22H,(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2 |
| InChIKey | MACGOVWEZWQBMW-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alizarin cyanin BBS (CHEBI:87367) has part 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonate (CHEBI:87371) |
| alizarin cyanin BBS (CHEBI:87367) has role fluorochrome (CHEBI:51217) |
| alizarin cyanin BBS (CHEBI:87367) has role histological dye (CHEBI:77178) |
| alizarin cyanin BBS (CHEBI:87367) is a organic sodium salt (CHEBI:38700) |
| alizarin cyanin BBS (CHEBI:87367) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| disodium 1,3,4,5,7,8-hexahydroxy-9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonate |
| Synonyms | Source |
|---|---|
| anthracene blue SWX | ChEBI |
| C.I. 58610 | ChEBI |
| mordant blue 23 | ChEBI |