EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | [H]C(=O)CCC(C)=O |
| InChI | InChI=1S/C5H8O2/c1-5(7)3-2-4-6/h4H,2-3H2,1H3 |
| InChIKey | KEHNRUNQZGRQHU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxopentanal (CHEBI:87363) has role metabolite (CHEBI:25212) |
| 4-oxopentanal (CHEBI:87363) is a ketoaldehyde (CHEBI:24960) |
| IUPAC Name |
|---|
| 4-oxopentanal |
| Synonym | Source |
|---|---|
| 1,4-pentanedione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1742045 | Reaxys |
| CAS:626-96-0 | ChemIDplus |