EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H7O7S.Na |
| Net Charge | 0 |
| Average Mass | 342.260 |
| Monoisotopic Mass | 341.98102 |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(S(=O)(=O)[O-])c(O)c2O.[Na+] |
| InChI | InChI=1S/C14H8O7S.Na/c15-11-6-3-1-2-4-7(6)12(16)10-8(11)5-9(22(19,20)21)13(17)14(10)18;/h1-5,17-18H,(H,19,20,21);/q;+1/p-1 |
| InChIKey | HFVAFDPGUJEFBQ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alizarin red S (CHEBI:87358) has part 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate (CHEBI:87361) |
| alizarin red S (CHEBI:87358) has role histological dye (CHEBI:77178) |
| alizarin red S (CHEBI:87358) is a organic sodium salt (CHEBI:38700) |
| alizarin red S (CHEBI:87358) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| sodium 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate |
| Synonyms | Source |
|---|---|
| 9,10-Dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenesulfonic acid monosodium salt | ChemIDplus |
| Acid Red Alizarine | ChemIDplus |
| Alizarin | ChEBI |
| Alizarin-3-sulfonate sodium salt | ChemIDplus |
| Alizarin carmine | ChEBI |
| Alizarine Red S sodium salt | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4117090 | Reaxys |
| CAS:130-22-3 | ChemIDplus |
| Citations |
|---|