EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H9NO4 |
| Net Charge | 0 |
| Average Mass | 291.262 |
| Monoisotopic Mass | 291.05316 |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(O)c(O)c1ncccc21 |
| InChI | InChI=1S/C17H9NO4/c19-14-8-4-1-2-5-9(8)15(20)12-11(14)10-6-3-7-18-13(10)17(22)16(12)21/h1-7,21-22H |
| InChIKey | JROURLWMOZCGJV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | acid-base indicator An acid or base which exhibits a colour change on neutralization by the basic or acidic titrant at or near the equivalence point of a titration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alizarin blue (CHEBI:87355) has role acid-base indicator (CHEBI:50407) |
| alizarin blue (CHEBI:87355) is a p-quinones (CHEBI:25830) |
| alizarin blue (CHEBI:87355) is a organic heterotetracyclic compound (CHEBI:38163) |
| alizarin blue (CHEBI:87355) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5,6-dihydroxynaphtho[2,3-f]quinoline-7,12-dione |
| Synonyms | Source |
|---|---|
| alizarin blue R | ChEBI |
| C.I. 67410 | ChEBI |