EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O.HCl |
| Net Charge | 0 |
| Average Mass | 274.751 |
| Monoisotopic Mass | 274.08729 |
| SMILES | C/N=c1\ccc2cc3ccc(NC)cc3oc-2c1.Cl |
| InChI | InChI=1S/C15H14N2O.ClH/c1-16-12-5-3-10-7-11-4-6-13(17-2)9-15(11)18-14(10)8-12;/h3-9,16H,1-2H3;1H/b17-13+; |
| InChIKey | IVHDZUFNZLETBM-IWSIBTJSSA-N |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acridine red 3B (CHEBI:87347) has part acridine red 3B(1+) (CHEBI:87351) |
| acridine red 3B (CHEBI:87347) has role histological dye (CHEBI:77178) |
| acridine red 3B (CHEBI:87347) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| N-methyl-3-(methylimino)-3H-xanthen-6-amine hydrochloride |
| N-methyl-6-(methylamino)-3H-xanthen-3-iminium chloride |
| Synonyms | Source |
|---|---|
| 3,6-Bis(methylamino)xanthylium chloride | ChemIDplus |
| acridine red | ChEBI |
| Acridine red, hydrochloride | ChemIDplus |
| Acridin Red | ChemIDplus |
| C.I. 45000 | ChEBI |
| Dimethyldiaminoxanthenyl chloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8871254 | Reaxys |
| CAS:2465-29-4 | ChemIDplus |