EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3 |
| Net Charge | 0 |
| Average Mass | 265.360 |
| Monoisotopic Mass | 265.15790 |
| SMILES | CN(C)c1ccc2cc3ccc(N(C)C)cc3nc2c1 |
| InChI | InChI=1S/C17H19N3/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14/h5-11H,1-4H3 |
| InChIKey | DPKHZNPWBDQZCN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acridine orange free base (CHEBI:87346) has role fluorochrome (CHEBI:51217) |
| acridine orange free base (CHEBI:87346) has role histological dye (CHEBI:77178) |
| acridine orange free base (CHEBI:87346) is a aminoacridines (CHEBI:51803) |
| acridine orange free base (CHEBI:87346) is a aromatic amine (CHEBI:33860) |
| acridine orange free base (CHEBI:87346) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N3,N3,N6,N6-tetramethylacridine-3,6-diamine |
| Synonyms | Source |
|---|---|
| 3,6-Bis(dimethylamino)acridine | ChemIDplus |
| 3,6-Di(dimethylamino)acridine | ChemIDplus |
| Acridine Orange | ChemIDplus |
| Acridine Orange Base | ChemIDplus |
| Brilliant Acridine Orange E | ChemIDplus |
| C.I. 46005B | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Acridine_orange | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20916 | Reaxys |
| CAS:494-38-2 | ChemIDplus |
| Citations |
|---|