EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O5 |
| Net Charge | 0 |
| Average Mass | 190.195 |
| Monoisotopic Mass | 190.08412 |
| SMILES | CC(=O)OCCOCCOC(C)=O |
| InChI | InChI=1S/C8H14O5/c1-7(9)12-5-3-11-4-6-13-8(2)10/h3-6H2,1-2H3 |
| InChIKey | UBPGILLNMDGSDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethylene glycol diacetate (CHEBI:87344) has functional parent diethylene glycol (CHEBI:46807) |
| diethylene glycol diacetate (CHEBI:87344) has role metabolite (CHEBI:25212) |
| diethylene glycol diacetate (CHEBI:87344) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| oxydi(ethane-2,1-diyl) diacetate |
| Synonym | Source |
|---|---|
| Oxydiethylene acetate | NIST Chemistry WebBook |