EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34O2 |
| Net Charge | 0 |
| Average Mass | 270.457 |
| Monoisotopic Mass | 270.25588 |
| SMILES | CCCCCCCCCCCC(=O)OCCC(C)C |
| InChI | InChI=1S/C17H34O2/c1-4-5-6-7-8-9-10-11-12-13-17(18)19-15-14-16(2)3/h16H,4-15H2,1-3H3 |
| InChIKey | FVKRIDSRWFEQME-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylbutyl dodecanoate (CHEBI:87343) has functional parent isoamylol (CHEBI:15837) |
| 3-methylbutyl dodecanoate (CHEBI:87343) has role metabolite (CHEBI:25212) |
| 3-methylbutyl dodecanoate (CHEBI:87343) is a dodecanoate ester (CHEBI:87659) |
| IUPAC Name |
|---|
| 3-methylbutyl dodecanoate |
| Synonyms | Source |
|---|---|
| isopentyl laurate | ChEBI |
| isoamyl laurate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6858295 | Reaxys |
| Citations |
|---|