EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O2 |
| Net Charge | 0 |
| Average Mass | 172.268 |
| Monoisotopic Mass | 172.14633 |
| SMILES | CC(=O)OC(C)CCCC(C)C |
| InChI | InChI=1S/C10H20O2/c1-8(2)6-5-7-9(3)12-10(4)11/h8-9H,5-7H2,1-4H3 |
| InChIKey | JNRDWRMJYGDQQE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methyl-2-heptanyl acetate (CHEBI:87332) has role metabolite (CHEBI:25212) |
| 6-methyl-2-heptanyl acetate (CHEBI:87332) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 6-methylheptan-2-yl acetate |
| Synonym | Source |
|---|---|
| 1,5-dimethylhexyl acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1758303 | Reaxys |
| CAS:67952-57-2 | ChemIDplus |
| CAS:67952-57-2 | NIST Chemistry WebBook |