EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O2 |
| Net Charge | 0 |
| Average Mass | 288.431 |
| Monoisotopic Mass | 288.20893 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@H](O)[C@@]4(C)CC[C@]3([H])[C@@]1(C)C=CC(=O)C2 |
| InChI | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,12,14-17,21H,3-6,8,10-11H2,1-2H3/t12-,14+,15+,16+,17+,18+,19+/m1/s1 |
| InChIKey | OKJCFMUGMSVJBG-MISPCMORSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21255593) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17β-hydroxy-5β-androst-1-en-3-one (CHEBI:87331) has functional parent 5β-androstane (CHEBI:20659) |
| 17β-hydroxy-5β-androst-1-en-3-one (CHEBI:87331) has role human xenobiotic metabolite (CHEBI:76967) |
| 17β-hydroxy-5β-androst-1-en-3-one (CHEBI:87331) is a 17β-hydroxy steroid (CHEBI:35343) |
| 17β-hydroxy-5β-androst-1-en-3-one (CHEBI:87331) is a 3-oxo-Δ1 steroid (CHEBI:20156) |
| IUPAC Name |
|---|
| 17β-hydroxy-5β-androst-1-en-3-one |
| Synonym | Source |
|---|---|
| (5β,17β)-17-hydroxyandrost-1-en-3-one | IUPAC |
| UniProt Name | Source |
|---|---|
| 17β-hydroxy-5β-androst-1-en-3-one | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5285306 | Reaxys |
| Citations |
|---|