EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O2 |
| Net Charge | 0 |
| Average Mass | 242.403 |
| Monoisotopic Mass | 242.22458 |
| SMILES | CCCCCCCCCC(=O)OCC(C)CC |
| InChI | InChI=1S/C15H30O2/c1-4-6-7-8-9-10-11-12-15(16)17-13-14(3)5-2/h14H,4-13H2,1-3H3 |
| InChIKey | JRJPVFOFQVUVLG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylbutyl decanoate (CHEBI:87330) has functional parent 2-methylbutan-1-ol (CHEBI:48945) |
| 2-methylbutyl decanoate (CHEBI:87330) has role metabolite (CHEBI:25212) |
| 2-methylbutyl decanoate (CHEBI:87330) is a decanoate ester (CHEBI:87658) |
| IUPAC Name |
|---|
| 2-methylbutyl decanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28168284 | Reaxys |