EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O2 |
| Net Charge | 0 |
| Average Mass | 170.252 |
| Monoisotopic Mass | 170.13068 |
| SMILES | [H]C(=CCCCCC)C(=O)OCC |
| InChI | InChI=1S/C10H18O2/c1-3-5-6-7-8-9-10(11)12-4-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | AISZSTYLOVXFII-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 2-octenoate (CHEBI:87325) has role metabolite (CHEBI:25212) |
| ethyl 2-octenoate (CHEBI:87325) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl oct-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1754134 | Reaxys |
| CAS:2351-90-8 | ChemIDplus |