EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O2 |
| Net Charge | 0 |
| Average Mass | 198.306 |
| Monoisotopic Mass | 198.16198 |
| SMILES | CCCCCCC/C=C/C(=O)OCC |
| InChI | InChI=1S/C12H22O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2/h10-11H,3-9H2,1-2H3/b11-10+ |
| InChIKey | GNJARWZWODMTDR-ZHACJKMWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl (2E)-2-decenoate (CHEBI:87324) has functional parent trans-2-decenoic acid (CHEBI:50467) |
| ethyl (2E)-2-decenoate (CHEBI:87324) has role metabolite (CHEBI:25212) |
| ethyl (2E)-2-decenoate (CHEBI:87324) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl (2E)-dec-2-enoate |
| Synonym | Source |
|---|---|
| trans-2-decenoic acid ethyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1704867 | Reaxys |
| CAS:7367-88-6 | ChemIDplus |