EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O4 |
| Net Charge | 0 |
| Average Mass | 188.223 |
| Monoisotopic Mass | 188.10486 |
| SMILES | CCOC(=O)CCCC(=O)OCC |
| InChI | InChI=1S/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
| InChIKey | OUWSNHWQZPEFEX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethyl glutarate (CHEBI:87319) has functional parent glutaric acid (CHEBI:17859) |
| diethyl glutarate (CHEBI:87319) has role metabolite (CHEBI:25212) |
| diethyl glutarate (CHEBI:87319) is a diester (CHEBI:51307) |
| IUPAC Name |
|---|
| diethyl pentanedioate |
| Synonyms | Source |
|---|---|
| diethyl 1,3-propanedicarboxylate | ChEBI |
| glutaric acid diethyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059879 | HMDB |