EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O2 |
| Net Charge | 0 |
| Average Mass | 144.214 |
| Monoisotopic Mass | 144.11503 |
| SMILES | CCCC(=O)OC(C)CC |
| InChI | InChI=1S/C8H16O2/c1-4-6-8(9)10-7(3)5-2/h7H,4-6H2,1-3H3 |
| InChIKey | QJHDFBAAFGELLO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sec-butyl butyrate (CHEBI:87318) has functional parent butan-2-ol (CHEBI:35687) |
| sec-butyl butyrate (CHEBI:87318) has role metabolite (CHEBI:25212) |
| sec-butyl butyrate (CHEBI:87318) is a butyrate ester (CHEBI:50477) |
| IUPAC Name |
|---|
| butan-2-yl butanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721096 | Reaxys |
| CAS:819-97-6 | ChemIDplus |