EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H28O |
| Net Charge | 0 |
| Average Mass | 200.366 |
| Monoisotopic Mass | 200.21402 |
| SMILES | CCCCCCC(O)CCCCCC |
| InChI | InChI=1S/C13H28O/c1-3-5-7-9-11-13(14)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | KWUWHKRBPALTGJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyalinella punctata (ncbitaxon:350064) | - | PubMed (24716585) | |
| Starmerella bacillaris (ncbitaxon:1247836) | - | MetaboLights (MTBLS212) | |
| Vitis vinifera (ncbitaxon:29760) | - | MetaboLights (MTBLS212) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridecan-7-ol (CHEBI:87311) has role animal metabolite (CHEBI:75767) |
| tridecan-7-ol (CHEBI:87311) has role plant metabolite (CHEBI:76924) |
| tridecan-7-ol (CHEBI:87311) is a secondary alcohol (CHEBI:35681) |
| tridecan-7-ol (CHEBI:87311) is a tridecanol (CHEBI:195620) |
| IUPAC Name |
|---|
| tridecan-7-ol |
| Synonyms | Source |
|---|---|
| 1-hexyl-1-heptanol | ChEBI |
| 7-hydroxytridecane | ChEBI |
| 7-tridecanol | ChEBI |
| 7-tridecyl alcohol | ChEBI |
| Citations |
|---|