EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8Cl2O |
| Net Charge | 0 |
| Average Mass | 155.024 |
| Monoisotopic Mass | 153.99522 |
| SMILES | ClC(Cl)C1CCCO1 |
| InChI | InChI=1S/C5H8Cl2O/c6-5(7)4-2-1-3-8-4/h4-5H,1-3H2 |
| InChIKey | LRRYUPYELLDERY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(dichloromethyl)tetrahydrofuran (CHEBI:87308) has parent hydride oxolane (CHEBI:26911) |
| 2-(dichloromethyl)tetrahydrofuran (CHEBI:87308) has role metabolite (CHEBI:25212) |
| 2-(dichloromethyl)tetrahydrofuran (CHEBI:87308) is a organochlorine compound (CHEBI:36683) |
| 2-(dichloromethyl)tetrahydrofuran (CHEBI:87308) is a oxolanes (CHEBI:26912) |
| IUPAC Name |
|---|
| 2-(dichloromethyl)oxolane |
| Synonym | Source |
|---|---|
| α,α-dichloromethyltetrahydrofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1280237 | Reaxys |