EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14 |
| Net Charge | 0 |
| Average Mass | 170.255 |
| Monoisotopic Mass | 170.10955 |
| SMILES | Cc1cc(C)c2cccc-2c(C)c1 |
| InChI | InChI=1S/C13H14/c1-9-7-10(2)12-5-4-6-13(12)11(3)8-9/h4-8H,1-3H3 |
| InChIKey | RUNBRXWUHPOTOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6,8-trimethylazulene (CHEBI:87304) has parent hydride azulene (CHEBI:31249) |
| 4,6,8-trimethylazulene (CHEBI:87304) has role metabolite (CHEBI:25212) |
| 4,6,8-trimethylazulene (CHEBI:87304) is a azulenes (CHEBI:38096) |
| IUPAC Name |
|---|
| 4,6,8-trimethylazulene |