EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O2 |
| Net Charge | 0 |
| Average Mass | 116.160 |
| Monoisotopic Mass | 116.08373 |
| SMILES | CCOC(=O)C(C)C |
| InChI | InChI=1S/C6H12O2/c1-4-8-6(7)5(2)3/h5H,4H2,1-3H3 |
| InChIKey | WDAXFOBOLVPGLV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl isobutyrate (CHEBI:87303) has functional parent isobutyric acid (CHEBI:16135) |
| ethyl isobutyrate (CHEBI:87303) has role plant metabolite (CHEBI:76924) |
| ethyl isobutyrate (CHEBI:87303) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl 2-methylpropanoate |
| Synonyms | Source |
|---|---|
| ethyl 2,2-dimethylacetate | ChemIDplus |
| isobutyric acid ethyl ester | ChEBI |
| ethyl isobutanoate | ChEBI |
| 2-methylpropionic acid ethyl ester | ChEBI |
| ethyl 2-methyl-1-propanoate | ChEBI |
| 2-methylpropanoic acid ethyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031248 | HMDB |
| FDB003278 | FooDB |
| C00053169 | KNApSAcK |
| Citations |
|---|