EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8O10P2 |
| Net Charge | 0 |
| Average Mass | 266.035 |
| Monoisotopic Mass | 265.95927 |
| SMILES | O=C(O)C(COP(=O)(O)O)OP(=O)(O)O |
| InChI | InChI=1S/C3H8O10P2/c4-3(5)2(13-15(9,10)11)1-12-14(6,7)8/h2H,1H2,(H,4,5)(H2,6,7,8)(H2,9,10,11) |
| InChIKey | XOHUEYCVLUUEJJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (2111310) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-bisphosphoglyceric acid (CHEBI:28907) has functional parent glyceric acid (CHEBI:33508) |
| 2,3-bisphosphoglyceric acid (CHEBI:28907) has role human metabolite (CHEBI:77746) |
| 2,3-bisphosphoglyceric acid (CHEBI:28907) is a bisphosphoglyceric acid (CHEBI:22902) |
| 2,3-bisphosphoglyceric acid (CHEBI:28907) is a tetronic acid derivative (CHEBI:63455) |
| 2,3-bisphosphoglyceric acid (CHEBI:28907) is conjugate acid of 2,3-bisphosphoglycerate (CHEBI:19324) |
| Incoming Relation(s) |
| 2,3-bisphospho-D-glyceric acid (CHEBI:17720) is a 2,3-bisphosphoglyceric acid (CHEBI:28907) |
| 3-phospho-D-glyceroyl dihydrogen phosphate (CHEBI:16001) is a 2,3-bisphosphoglyceric acid (CHEBI:28907) |
| 2,3-bisphosphoglycerate (CHEBI:19324) is conjugate base of 2,3-bisphosphoglyceric acid (CHEBI:28907) |
| IUPAC Name |
|---|
| 2,3-bis(phosphonooxy)propanoic acid |
| Citations |
|---|