EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | C=CCCCC(=O)OCC |
| InChI | InChI=1S/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h3H,1,4-7H2,2H3 |
| InChIKey | RJLJOXJZWMGEFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 5-hexenoate (CHEBI:87299) has role flavouring agent (CHEBI:35617) |
| ethyl 5-hexenoate (CHEBI:87299) has role metabolite (CHEBI:25212) |
| ethyl 5-hexenoate (CHEBI:87299) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl hex-5-enoate |
| Synonym | Source |
|---|---|
| 5-(ethoxycarbonyl)-1-pentene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO0113742 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1750177 | Reaxys |
| Citations |
|---|