EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18OSe |
| Net Charge | 0 |
| Average Mass | 221.202 |
| Monoisotopic Mass | 222.05229 |
| SMILES | CCCC[Se]C(=O)CCCC |
| InChI | InChI=1S/C9H18OSe/c1-3-5-7-9(10)11-8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | QICNIASPGMAXAY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Se-butyl pentaneselenoate (CHEBI:87297) has role metabolite (CHEBI:25212) |
| Se-butyl pentaneselenoate (CHEBI:87297) is a organoselenium compound (CHEBI:25712) |
| IUPAC Name |
|---|
| Se-butyl pentaneselenoate |
| Synonym | Source |
|---|---|
| Se-butyl butanecarboselenoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7914059 | Reaxys |