EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CC(O)C1COC(=O)C1 |
| InChI | InChI=1S/C6H10O3/c1-4(7)5-2-6(8)9-3-5/h4-5,7H,2-3H2,1H3 |
| InChIKey | SDQNMZALKPBELF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(1-hydroxyethyl)-γ-butanolactone (CHEBI:87296) has role metabolite (CHEBI:25212) |
| 4-(1-hydroxyethyl)-γ-butanolactone (CHEBI:87296) is a butan-4-olide (CHEBI:22950) |
| 4-(1-hydroxyethyl)-γ-butanolactone (CHEBI:87296) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 4-(1-hydroxyethyl)oxolan-2-one |
| Synonym | Source |
|---|---|
| 3-(1-hydroxyethyl)butanolide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4962238 | Reaxys |