EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | COC(OC)C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12O4/c1-14-11(15-2)10(13)9(12)8-6-4-3-5-7-8/h3-7,11H,1-2H3 |
| InChIKey | IUNQJUIIJBHXDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3-dimethoxy-1-phenylpropane-1,2-dione (CHEBI:87292) has role metabolite (CHEBI:25212) |
| 3,3-dimethoxy-1-phenylpropane-1,2-dione (CHEBI:87292) is a aromatic ketone (CHEBI:76224) |
| 3,3-dimethoxy-1-phenylpropane-1,2-dione (CHEBI:87292) is a ether (CHEBI:25698) |
| 3,3-dimethoxy-1-phenylpropane-1,2-dione (CHEBI:87292) is a α-diketone (CHEBI:51869) |
| IUPAC Name |
|---|
| 3,3-dimethoxy-1-phenylpropane-1,2-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4743805 | Reaxys |