EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18 |
| Net Charge | 0 |
| Average Mass | 138.254 |
| Monoisotopic Mass | 138.14085 |
| SMILES | [H]C(=CCC)CC(C=C)CC |
| InChI | InChI=1S/C10H18/c1-4-7-8-9-10(5-2)6-3/h5,7-8,10H,2,4,6,9H2,1,3H3 |
| InChIKey | DXYBMKOHVHUXNV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-ethyl-1,5-octadiene (CHEBI:87288) has role metabolite (CHEBI:25212) |
| 3-ethyl-1,5-octadiene (CHEBI:87288) is a alkadiene (CHEBI:33646) |
| IUPAC Name |
|---|
| 3-ethylocta-1,5-diene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720180 | Reaxys |