EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O3 |
| Net Charge | 0 |
| Average Mass | 170.208 |
| Monoisotopic Mass | 170.09429 |
| SMILES | CCOCC(OC)c1ccco1 |
| InChI | InChI=1S/C9H14O3/c1-3-11-7-9(10-2)8-5-4-6-12-8/h4-6,9H,3,7H2,1-2H3 |
| InChIKey | QAPKSMIEGHZSPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-ethoxy-1-methoxyethyl)furan (CHEBI:87286) has role metabolite (CHEBI:25212) |
| 2-(2-ethoxy-1-methoxyethyl)furan (CHEBI:87286) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 2-(2-ethoxy-1-methoxyethyl)furan |