EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23O3P |
| Net Charge | 0 |
| Average Mass | 270.309 |
| Monoisotopic Mass | 270.13848 |
| SMILES | CCCCP(=O)(OCC)OCCc1ccccc1 |
| InChI | InChI=1S/C14H23O3P/c1-3-5-13-18(15,16-4-2)17-12-11-14-9-7-6-8-10-14/h6-10H,3-5,11-13H2,1-2H3 |
| InChIKey | PQWBNCIKGJGHRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 2-phenylethyl butylphosphonate (CHEBI:87285) has functional parent butylphosphonic acid (CHEBI:41384) |
| ethyl 2-phenylethyl butylphosphonate (CHEBI:87285) has role metabolite (CHEBI:25212) |
| ethyl 2-phenylethyl butylphosphonate (CHEBI:87285) is a phosphonic ester (CHEBI:37735) |
| IUPAC Name |
|---|
| ethyl 2-phenylethyl butylphosphonate |