EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O2S |
| Net Charge | 0 |
| Average Mass | 148.227 |
| Monoisotopic Mass | 148.05580 |
| SMILES | CSCCCOC(C)=O |
| InChI | InChI=1S/C6H12O2S/c1-6(7)8-4-3-5-9-2/h3-5H2,1-2H3 |
| InChIKey | LPZQTNIAYMRVMF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylthiopropyl acetate (CHEBI:87281) has functional parent 3-methylthiopropanol (CHEBI:49019) |
| 3-methylthiopropyl acetate (CHEBI:87281) has role metabolite (CHEBI:25212) |
| 3-methylthiopropyl acetate (CHEBI:87281) is a acetate ester (CHEBI:47622) |
| 3-methylthiopropyl acetate (CHEBI:87281) is a methyl sulfide (CHEBI:86315) |
| IUPAC Name |
|---|
| 3-(methylsulfanyl)propyl acetate |
| Citations |
|---|