EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O4 |
| Net Charge | 0 |
| Average Mass | 216.277 |
| Monoisotopic Mass | 216.13616 |
| SMILES | CCOC(=O)CCC(=O)OCCC(C)C |
| InChI | InChI=1S/C11H20O4/c1-4-14-10(12)5-6-11(13)15-8-7-9(2)3/h9H,4-8H2,1-3H3 |
| InChIKey | GCXHTVAWZRIFAV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 3-methylbutyl butanedioate (CHEBI:87276) has functional parent succinic acid (CHEBI:15741) |
| ethyl 3-methylbutyl butanedioate (CHEBI:87276) has role metabolite (CHEBI:25212) |
| ethyl 3-methylbutyl butanedioate (CHEBI:87276) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| ethyl 3-methylbutyl butanedioate (CHEBI:87276) is a diester (CHEBI:51307) |
| ethyl 3-methylbutyl butanedioate (CHEBI:87276) is a succinate ester (CHEBI:36181) |
| IUPAC Name |
|---|
| ethyl 3-methylbutyl butanedioate |
| Synonym | Source |
|---|---|
| ethyl 3-methylbutyl succinate | ChEBI |