EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O3 |
| Net Charge | 0 |
| Average Mass | 174.240 |
| Monoisotopic Mass | 174.12559 |
| SMILES | CCCCCOCCOC(C)=O |
| InChI | InChI=1S/C9H18O3/c1-3-4-5-6-11-7-8-12-9(2)10/h3-8H2,1-2H3 |
| InChIKey | INRKVKPTZMIOTG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(pentyloxy)ethyl acetate (CHEBI:87270) has role metabolite (CHEBI:25212) |
| 2-(pentyloxy)ethyl acetate (CHEBI:87270) is a acetate ester (CHEBI:47622) |
| 2-(pentyloxy)ethyl acetate (CHEBI:87270) is a ether (CHEBI:25698) |
| IUPAC Name |
|---|
| 2-(pentyloxy)ethyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1856516 | Reaxys |