EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | [H]C(=O)C(C)OC(C)C(=O)O |
| InChI | InChI=1S/C6H10O4/c1-4(3-7)10-5(2)6(8)9/h3-5H,1-2H3,(H,8,9) |
| InChIKey | PXTAAGVROLGXED-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(carboxyethoxy)propanal (CHEBI:87268) has role metabolite (CHEBI:25212) |
| 2-(carboxyethoxy)propanal (CHEBI:87268) is a aldehyde (CHEBI:17478) |
| 2-(carboxyethoxy)propanal (CHEBI:87268) is a ether (CHEBI:25698) |
| 2-(carboxyethoxy)propanal (CHEBI:87268) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 2-[(1-oxopropan-2-yl)oxy]propanoic acid |