EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O4 |
| Net Charge | 0 |
| Average Mass | 174.196 |
| Monoisotopic Mass | 174.08921 |
| SMILES | COC/C=C/C(OC)OC(C)=O |
| InChI | InChI=1S/C8H14O4/c1-7(9)12-8(11-3)5-4-6-10-2/h4-5,8H,6H2,1-3H3/b5-4+ |
| InChIKey | GAKZYUOVCHCSBU-SNAWJCMRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-1,4-dimethoxybut-2-en-1-yl acetate (CHEBI:87267) has role metabolite (CHEBI:25212) |
| (2E)-1,4-dimethoxybut-2-en-1-yl acetate (CHEBI:87267) is a acetate ester (CHEBI:47622) |
| (2E)-1,4-dimethoxybut-2-en-1-yl acetate (CHEBI:87267) is a ether (CHEBI:25698) |
| (2E)-1,4-dimethoxybut-2-en-1-yl acetate (CHEBI:87267) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (2E)-1,4-dimethoxybut-2-en-1-yl acetate |
| Synonym | Source |
|---|---|
| trans-1-acetoxy-1,4-dimethoxy-2-butene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1937605 | Reaxys |