EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19ClO2 |
| Net Charge | 0 |
| Average Mass | 206.713 |
| Monoisotopic Mass | 206.10736 |
| SMILES | CCCC(Cl)CCCCOC(C)=O |
| InChI | InChI=1S/C10H19ClO2/c1-3-6-10(11)7-4-5-8-13-9(2)12/h10H,3-8H2,1-2H3 |
| InChIKey | MCTSGNCLJHZLHV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chlorooctyl acetate (CHEBI:87266) has role metabolite (CHEBI:25212) |
| 5-chlorooctyl acetate (CHEBI:87266) is a acetate ester (CHEBI:47622) |
| 5-chlorooctyl acetate (CHEBI:87266) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 5-chlorooctyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6188730 | Reaxys |