EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H33N3O13 |
| Net Charge | 0 |
| Average Mass | 511.481 |
| Monoisotopic Mass | 511.20134 |
| SMILES | CC(=O)N[C@H]1[C@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@H](OC[C@H](N)C(=O)O)[C@@H]2NC(C)=O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H33N3O13/c1-6(25)21-11-15(29)13(27)9(3-23)34-19(11)35-16-12(22-7(2)26)18(32-5-8(20)17(30)31)33-10(4-24)14(16)28/h8-16,18-19,23-24,27-29H,3-5,20H2,1-2H3,(H,21,25)(H,22,26)(H,30,31)/t8-,9+,10+,11+,12+,13+,14-,15+,16+,18-,19-/m0/s1 |
| InChIKey | HXQDSZVWOBOHOU-VQMGDWKRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-[N-acetyl-β-D-glucosaminyl-(1→3)-N-acetyl-α-D-galactosaminyl]-L-serine (CHEBI:87260) is a O-glycosyl-L-serine (CHEBI:21957) |
| O-[N-acetyl-β-D-glucosaminyl-(1→3)-N-acetyl-α-D-galactosaminyl]-L-serine (CHEBI:87260) is a disaccharide derivative (CHEBI:63353) |
| Incoming Relation(s) |
| N-acetyl-β-D-glucosaminyl-(1→3)-N-acetyl-α-D-galactosaminyl-L-serine residue (CHEBI:87079) is substituent group from O-[N-acetyl-β-D-glucosaminyl-(1→3)-N-acetyl-α-D-galactosaminyl]-L-serine (CHEBI:87260) |
| Synonym | Source |
|---|---|
| β-D-GlcNAc-(1→3)-α-D-GalNAc-L-Ser | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6029674 | Reaxys |