EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O5 |
| Net Charge | 0 |
| Average Mass | 198.174 |
| Monoisotopic Mass | 198.05282 |
| SMILES | CCOC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C9H10O5/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,10-12H,2H2,1H3 |
| InChIKey | VFPFQHQNJCMNBZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dimocarpus longan (ncbitaxon:128017) | seed (BTO:0001226) | PubMed (24533783]) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl gallate (CHEBI:87247) has role plant metabolite (CHEBI:76924) |
| ethyl gallate (CHEBI:87247) is a gallate ester (CHEBI:37576) |
| IUPAC Name |
|---|
| ethyl 3,4,5-trihydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033836 | HMDB |
| Citations |
|---|