EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15N3O3S |
| Net Charge | 0 |
| Average Mass | 353.403 |
| Monoisotopic Mass | 353.08341 |
| SMILES | O=S(=O)(O)c1cccc(N=Nc2ccc(Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C18H15N3O3S/c22-25(23,24)18-8-4-7-17(13-18)21-20-16-11-9-15(10-12-16)19-14-5-2-1-3-6-14/h1-13,19H,(H,22,23,24) |
| InChIKey | HLISYGBBLOOIQF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonic acid (CHEBI:87240) is a arenesulfonic acid (CHEBI:33555) |
| 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonic acid (CHEBI:87240) is a aromatic amine (CHEBI:33860) |
| 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonic acid (CHEBI:87240) is a azobenzenes (CHEBI:22682) |
| 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonic acid (CHEBI:87240) is a secondary amino compound (CHEBI:50995) |
| 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonic acid (CHEBI:87240) is conjugate acid of 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonate (CHEBI:87238) |
| Incoming Relation(s) |
| 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonate (CHEBI:87238) is conjugate base of 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonic acid (CHEBI:87240) |
| IUPAC Name |
|---|
| 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| 4-(Phenylamino)-3'-sulfoazobenzene | ChemIDplus |
| Metanil yellow | ChemIDplus |
| Metanil yellow free acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1844713 | Reaxys |
| CAS:4005-68-9 | ChemIDplus |