EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18ClN5O2 |
| Net Charge | 0 |
| Average Mass | 359.817 |
| Monoisotopic Mass | 359.11490 |
| SMILES | Nc1ncnc2c1c(COc1cccc(Cl)c1)nn2C1CCOCC1 |
| InChI | InChI=1S/C17H18ClN5O2/c18-11-2-1-3-13(8-11)25-9-14-15-16(19)20-10-21-17(15)23(22-14)12-4-6-24-7-5-12/h1-3,8,10,12H,4-7,9H2,(H2,19,20,21) |
| InChIKey | AUMDBEHGJRZSOO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-4800567 (CHEBI:87237) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| PF-4800567 (CHEBI:87237) is a aromatic ether (CHEBI:35618) |
| PF-4800567 (CHEBI:87237) is a monochlorobenzenes (CHEBI:83403) |
| PF-4800567 (CHEBI:87237) is a oxanes (CHEBI:46942) |
| PF-4800567 (CHEBI:87237) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| 3-[(3-chlorophenoxy)methyl]-1-(tetrahydro-2H-pyran-4-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Synonym | Source |
|---|---|
| PF-480 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| PF-4800567 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24283230 | Reaxys |
| Citations |
|---|