EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20FN5.2HCl |
| Net Charge | 0 |
| Average Mass | 410.324 |
| Monoisotopic Mass | 409.12363 |
| SMILES | Cl.Cl.Nc1nccc(-c2c(-c3ccc(F)cc3)ncn2C2CCCCC2)n1 |
| InChI | InChI=1S/C19H20FN5.2ClH/c20-14-8-6-13(7-9-14)17-18(16-10-11-22-19(21)24-16)25(12-23-17)15-4-2-1-3-5-15;;/h6-12,15H,1-5H2,(H2,21,22,24);2*1H |
| InChIKey | PSNKGVAXBSAHCH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-670462 (CHEBI:87236) has part PF-670462 free base(2+) (CHEBI:87284) |
| PF-670462 (CHEBI:87236) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| PF-670462 (CHEBI:87236) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-[1-cyclohexyl-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyrimidin-2-amine dihydrochloride |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11152377 | Reaxys |
| CAS:950912-80-8 | ChemIDplus |
| Citations |
|---|