EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N3O3S.Na |
| Net Charge | 0 |
| Average Mass | 375.385 |
| Monoisotopic Mass | 375.06536 |
| SMILES | O=S(=O)([O-])c1cccc(N=Nc2ccc(Nc3ccccc3)cc2)c1.[Na+] |
| InChI | InChI=1S/C18H15N3O3S.Na/c22-25(23,24)18-8-4-7-17(13-18)21-20-16-11-9-15(10-12-16)19-14-5-2-1-3-6-14;/h1-13,19H,(H,22,23,24);/q;+1/p-1 |
| InChIKey | NYGZLYXAPMMJTE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metanil yellow (CHEBI:87235) has part 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonate (CHEBI:87238) |
| metanil yellow (CHEBI:87235) has role histological dye (CHEBI:77178) |
| metanil yellow (CHEBI:87235) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| acid yellow 36 | ChEBI |
| C.I. 13065 | ChEBI |
| C.I. Acid Yellow 36 | ChemIDplus |
| C.I. Acid Yellow 36 monosodium salt | ChemIDplus |
| Sodium 4'-anilinoazobenzene-3-sulfonate | ChemIDplus |
| Sodium m-(4-anilinophenylazo)benzenesulfonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3831568 | Reaxys |
| CAS:587-98-4 | ChemIDplus |
| Citations |
|---|