EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14N2O5S |
| Net Charge | 0 |
| Average Mass | 382.397 |
| Monoisotopic Mass | 382.06234 |
| SMILES | Cc1ccc(N2C(=O)c3cccc4c(N)c(S(=O)(=O)O)cc(c34)C2=O)cc1 |
| InChI | InChI=1S/C19H14N2O5S/c1-10-5-7-11(8-6-10)21-18(22)13-4-2-3-12-16(13)14(19(21)23)9-15(17(12)20)27(24,25)26/h2-9H,20H2,1H3,(H,24,25,26) |
| InChIKey | NISZMWZPLJGKCC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lissamine flavine FF free acid (CHEBI:87233) is a arenesulfonic acid (CHEBI:33555) |
| lissamine flavine FF free acid (CHEBI:87233) is a aromatic amine (CHEBI:33860) |
| lissamine flavine FF free acid (CHEBI:87233) is a benzoisoquinoline (CHEBI:39200) |
| lissamine flavine FF free acid (CHEBI:87233) is a dicarboximide (CHEBI:35356) |
| lissamine flavine FF free acid (CHEBI:87233) is conjugate acid of lissamine flavine FF(1−) (CHEBI:87231) |
| Incoming Relation(s) |
| lissamine flavine FF(1−) (CHEBI:87231) is conjugate base of lissamine flavine FF free acid (CHEBI:87233) |
| IUPAC Name |
|---|
| 6-amino-2-(4-methylphenyl)-1,3-dioxo-2,3-dihydro-1H-benzo[de]isoquinoline-5-sulfonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:353863 | Reaxys |