EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H13N2O5S.Na |
| Net Charge | 0 |
| Average Mass | 404.379 |
| Monoisotopic Mass | 404.04429 |
| SMILES | Cc1ccc(N2C(=O)c3cccc4c(N)c(S(=O)(=O)[O-])cc(c34)C2=O)cc1.[Na+] |
| InChI | InChI=1S/C19H14N2O5S.Na/c1-10-5-7-11(8-6-10)21-18(22)13-4-2-3-12-16(13)14(19(21)23)9-15(17(12)20)27(24,25)26;/h2-9H,20H2,1H3,(H,24,25,26);/q;+1/p-1 |
| InChIKey | HYLDLLCHFLSKAG-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lissamine flavine FF (CHEBI:87226) has part lissamine flavine FF(1−) (CHEBI:87231) |
| lissamine flavine FF (CHEBI:87226) has role histological dye (CHEBI:77178) |
| lissamine flavine FF (CHEBI:87226) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 6-amino-2-(4-methylphenyl)-1,3-dioxo-2,3-dihydro-1H-benzo[de]isoquinoline-5-sulfonate |
| Synonyms | Source |
|---|---|
| acid yellow 7 | ChEBI |
| brilliant acid yellow 8G | ChEBI |
| Brilliant sulfaflavine | ChemIDplus |
| brilliant sulpho flavine FF | ChEBI |
| C.I. 56205 | ChEBI |
| C.I. Acid Yellow 7 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3848264 | Reaxys |
| CAS:2391-30-2 | ChemIDplus |
| Citations |
|---|