EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6N2O8S |
| Net Charge | 0 |
| Average Mass | 314.231 |
| Monoisotopic Mass | 313.98449 |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2ccc(S(=O)(=O)O)cc2c1O |
| InChI | InChI=1S/C10H6N2O8S/c13-10-7-3-5(21(18,19)20)1-2-6(7)8(11(14)15)4-9(10)12(16)17/h1-4,13H,(H,18,19,20) |
| InChIKey | FCQJEPASRCXVCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavianic acid (CHEBI:87221) has role histological dye (CHEBI:77178) |
| flavianic acid (CHEBI:87221) is a C-nitro compound (CHEBI:35716) |
| flavianic acid (CHEBI:87221) is a naphthalenesulfonic acid (CHEBI:36336) |
| flavianic acid (CHEBI:87221) is a naphthols (CHEBI:25392) |
| flavianic acid (CHEBI:87221) is conjugate acid of flavianate (CHEBI:87220) |
| Incoming Relation(s) |
| flavianate (CHEBI:87220) is conjugate base of flavianic acid (CHEBI:87221) |
| IUPAC Name |
|---|
| 8-hydroxy-5,7-dinitronaphthalene-2-sulfonic acid |
| Synonyms | Source |
|---|---|
| 2,4-Dinitro-1-naphthol-7-sulfonic acid | ChemIDplus |
| 2,4-Dinitronaphtholsulfonic acid | ChemIDplus |
| Naphthol Yellow | ChemIDplus |
| Citations |
|---|