EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H4N2O8S.2Na |
| Net Charge | 0 |
| Average Mass | 358.195 |
| Monoisotopic Mass | 357.94837 |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2ccc(S(=O)(=O)[O-])cc2c1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H6N2O8S.2Na/c13-10-7-3-5(21(18,19)20)1-2-6(7)8(11(14)15)4-9(10)12(16)17;;/h1-4,13H,(H,18,19,20);;/q;2*+1/p-2 |
| InChIKey | CTIQLGJVGNGFEW-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthol yellow S (CHEBI:87219) has part flavianate (CHEBI:87220) |
| naphthol yellow S (CHEBI:87219) has role histological dye (CHEBI:77178) |
| naphthol yellow S (CHEBI:87219) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 5,7-dinitro-8-oxidonaphthalene-2-sulfonate |
| Synonyms | Source |
|---|---|
| C.I. 10316 | ChEBI |
| acid yellow 1 | ChEBI |
| sulfur yellow S | ChEBI |
| acid yellow S | ChEBI |
| C.I. Food Yellow 1 | ChemIDplus |
| C.I. Acid Yellow 1 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Naphthol_yellow_S | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3839220 | Reaxys |
| CAS:846-70-8 | ChemIDplus |
| Citations |
|---|