EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H17N3O9S3.2Na |
| Net Charge | 0 |
| Average Mass | 681.637 |
| Monoisotopic Mass | 680.99223 |
| SMILES | O=S(=O)([O-])c1ccc(Nc2cc3c(nc4ccccc4[n+]3-c3ccccc3)c3ccc(S(=O)(=O)[O-])cc23)c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C28H19N3O9S3.2Na/c32-41(33,34)18-10-12-20-21(14-18)24(29-23-13-11-19(42(35,36)37)15-27(23)43(38,39)40)16-26-28(20)30-22-8-4-5-9-25(22)31(26)17-6-2-1-3-7-17;;/h1-16H,(H3,32,33,34,35,36,37,38,39,40);;/q;2*+1/p-2 |
| InChIKey | QZKHGYGBYOUFGK-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azocarmine B (CHEBI:87214) has part azocarmine B(2−) (CHEBI:87216) |
| azocarmine B (CHEBI:87214) has role histological dye (CHEBI:77178) |
| azocarmine B (CHEBI:87214) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 4-[(7-phenyl-3-sulfonatobenzo[a]phenazin-7-ium-5-yl)amino]benzene-1,3-disulfonate |
| Synonyms | Source |
|---|---|
| Acid red 103 | ChEBI |
| C.I. 50090 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14926140 | Reaxys |
| Citations |
|---|