EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H18N3O6S2.Na |
| Net Charge | 0 |
| Average Mass | 579.591 |
| Monoisotopic Mass | 579.05347 |
| SMILES | O=S(=O)([O-])c1ccc(Nc2cc3c(nc4ccccc4[n+]3-c3ccccc3)c3ccc(S(=O)(=O)[O-])cc23)cc1.[Na+] |
| InChI | InChI=1S/C28H19N3O6S2.Na/c32-38(33,34)20-12-10-18(11-13-20)29-25-17-27-28(22-15-14-21(16-23(22)25)39(35,36)37)30-24-8-4-5-9-26(24)31(27)19-6-2-1-3-7-19;/h1-17H,(H2,32,33,34,35,36,37);/q;+1/p-1 |
| InChIKey | LUERODMRBLNCFK-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azocarmine G (CHEBI:87206) has part azocarmine G(1−) (CHEBI:87212) |
| azocarmine G (CHEBI:87206) has role histological dye (CHEBI:77178) |
| azocarmine G (CHEBI:87206) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 7-phenyl-5-(4-sulfonatoanilino)benzo[a]phenazin-7-ium-3-sulfonate |
| Synonyms | Source |
|---|---|
| acid red 101 | ChEBI |
| C.I. 50085 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20197903 | Reaxys |
| CAS:25641-18-3 | ChemIDplus |
| Citations |
|---|