EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H2Br4Cl4O5.2Na |
| Net Charge | 0 |
| Average Mass | 829.639 |
| Monoisotopic Mass | 823.51852 |
| SMILES | O=C([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(Br)c([O-])c(Br)cc12.[Na+].[Na+] |
| InChI | InChI=1S/C20H4Br4Cl4O5.2Na/c21-5-1-3-7(8-9(20(31)32)13(26)15(28)14(27)12(8)25)4-2-6(22)17(30)11(24)19(4)33-18(3)10(23)16(5)29;;/h1-2,29H,(H,31,32);;/q;2*+1/p-2 |
| InChIKey | GVKCHTBDSMQENH-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phloxine B (CHEBI:87192) has part 2',4',5',7'-tetrabromo-2,3,4,5-tetrachlorofluorescein(2−) (CHEBI:87196) |
| phloxine B (CHEBI:87192) has role fluorochrome (CHEBI:51217) |
| phloxine B (CHEBI:87192) has role histological dye (CHEBI:77178) |
| phloxine B (CHEBI:87192) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 2,3,4,5-tetrachloro-6-(2,4,5,7-tetrabromo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate |
| Synonyms | Source |
|---|---|
| acid red 92 | ChEBI |
| C.I. 45410 | ChEBI |
| D&C Red No. 28 | ChemIDplus |
| phloxine | ChEBI |
| Citations |
|---|