EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14N4O7S2.2Na |
| Net Charge | 0 |
| Average Mass | 556.489 |
| Monoisotopic Mass | 556.00993 |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)[O-])c2c(N=Nc3ccc(N=Nc4ccccc4)cc3)c(O)ccc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C22H16N4O7S2.2Na/c27-19-11-6-14-12-18(34(28,29)30)13-20(35(31,32)33)21(14)22(19)26-25-17-9-7-16(8-10-17)24-23-15-4-2-1-3-5-15;;/h1-13,27H,(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2 |
| InChIKey | PEAGNRWWSMMRPZ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| woodstain scarlet (CHEBI:87189) has part 7-hydroxy-8-{[4-(phenyldiazenyl)phenyl]diazenyl}naphthalene-1,3-disulfonate (CHEBI:87191) |
| woodstain scarlet (CHEBI:87189) has role histological dye (CHEBI:77178) |
| woodstain scarlet (CHEBI:87189) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 7-hydroxy-8-{[4-(phenyldiazenyl)phenyl]diazenyl}naphthalene-1,3-disulfonate |
| Synonyms | Source |
|---|---|
| brilliant crocein MOO | ChEBI |
| crocein scarlet MOO | ChEBI |
| crocein scarlet 3B | ChEBI |
| C.I. 27290 | ChEBI |
| acid red 73 | ChEBI |
| C.I. Acid Red 73, disodium salt | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8032521 | Reaxys |
| CAS:5413-75-2 | ChemIDplus |
| Citations |
|---|