EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87184 - hexamidine
| Formula | C20H26N4O2 |
| Net Charge | 0 |
| Average Mass | 354.454 |
| Monoisotopic Mass | 354.20558 |
| SMILES | N=C(N)c1ccc(OCCCCCCOc2ccc(C(=N)N)cc2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c21-19(22)15-5-9-17(10-6-15)25-13-3-1-2-4-14-26-18-11-7-16(8-12-18)20(23)24/h5-12H,1-4,13-14H2,(H3,21,22)(H3,23,24) |
| InChIKey | OQLKNTOKMBVBKV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexamidine (CHEBI:87184) has functional parent hexane-1,6-diol (CHEBI:43078) |
| hexamidine (CHEBI:87184) has role antimicrobial agent (CHEBI:33281) |
| hexamidine (CHEBI:87184) has role antiseptic drug (CHEBI:48218) |
| hexamidine (CHEBI:87184) has role nasal decongestant (CHEBI:77715) |
| hexamidine (CHEBI:87184) has role ophthalmology drug (CHEBI:66981) |
| hexamidine (CHEBI:87184) is a aromatic ether (CHEBI:35618) |
| hexamidine (CHEBI:87184) is a guanidines (CHEBI:24436) |
| hexamidine (CHEBI:87184) is a polyether (CHEBI:46774) |
| IUPAC Name |
|---|
| 4,4'-[hexane-1,6-diylbis(oxy)]di(benzene-1-carboximidamide) |
| INNs | Source |
|---|---|
| hexamidina | ChemIDplus |
| hexamidine | ChemIDplus |
| hexamidine | ChemIDplus |
| hexamidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4,4'-(1,6-Hexanediylbis(oxy))bis-benzenecarboximidamide | ChemIDplus |
| 4,4'-(Hexamethylenedioxy)dibenzamidine | ChemIDplus |
| Citations |
|---|