EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87184 - hexamidine
| Formula | C20H26N4O2 |
| Net Charge | 0 |
| Average Mass | 354.454 |
| Monoisotopic Mass | 354.20558 |
| SMILES | N=C(N)c1ccc(OCCCCCCOc2ccc(C(=N)N)cc2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c21-19(22)15-5-9-17(10-6-15)25-13-3-1-2-4-14-26-18-11-7-16(8-12-18)20(23)24/h5-12H,1-4,13-14H2,(H3,21,22)(H3,23,24) |
| InChIKey | OQLKNTOKMBVBKV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexamidine (CHEBI:87184) has functional parent hexane-1,6-diol (CHEBI:43078) |
| hexamidine (CHEBI:87184) has role antimicrobial agent (CHEBI:33281) |
| hexamidine (CHEBI:87184) has role antiseptic drug (CHEBI:48218) |
| hexamidine (CHEBI:87184) is a aromatic ether (CHEBI:35618) |
| hexamidine (CHEBI:87184) is a guanidines (CHEBI:24436) |
| hexamidine (CHEBI:87184) is a polyether (CHEBI:46774) |
| IUPAC Name |
|---|
| 4,4'-[hexane-1,6-diylbis(oxy)]di(benzene-1-carboximidamide) |
| INNs | Source |
|---|---|
| hexamidina | ChemIDplus |
| hexamidine | ChemIDplus |
| hexamidine | ChemIDplus |
| hexamidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4,4'-(1,6-Hexanediylbis(oxy))bis-benzenecarboximidamide | ChemIDplus |
| 4,4'-(Hexamethylenedioxy)dibenzamidine | ChemIDplus |
| Citations |
|---|