EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N4O2.2C2H6O4S |
| Net Charge | 0 |
| Average Mass | 564.639 |
| Monoisotopic Mass | 564.15599 |
| SMILES | N=C(N)c1ccc(OCCCOc2ccc(C(=N)N)cc2)cc1.O=S(=O)(O)CCO.O=S(=O)(O)CCO |
| InChI | InChI=1S/C17H20N4O2.2C2H6O4S/c18-16(19)12-2-6-14(7-3-12)22-10-1-11-23-15-8-4-13(5-9-15)17(20)21;2*3-1-2-7(4,5)6/h2-9H,1,10-11H2,(H3,18,19)(H3,20,21);2*3H,1-2H2,(H,4,5,6) |
| InChIKey | WSOSYBUSMXEYDO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propamidine isethionate (CHEBI:87175) has part propamidine(2+) (CHEBI:87463) |
| propamidine isethionate (CHEBI:87175) has role antimicrobial agent (CHEBI:33281) |
| propamidine isethionate (CHEBI:87175) has role antiseptic drug (CHEBI:48218) |
| propamidine isethionate (CHEBI:87175) is a guanidinium salt (CHEBI:83635) |
| propamidine isethionate (CHEBI:87175) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Names |
|---|
| 2-hydroxyethane-1-sulfonic acid—4,4'-[propane-1,3-diylbis(oxy)]di(benzene-1-carboximidamide) (2/1) |
| [propane-1,3-diylbis(oxy-4,1-phenylene)]bis(iminomethanaminium) bis(2-hydroxyethane-1-sulfonate) |
| Synonyms | Source |
|---|---|
| M + B 782 | ChemIDplus |
| M&B 782 | ChemIDplus |
| Propamidine diisethionate | ChemIDplus |
| Propamidine isethionate | SUBMITTER |
| Brand Name | Source |
|---|---|
| Golden eye drops | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D08436 | KEGG DRUG |
| Propamidine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8178459 | Reaxys |
| CAS:140-63-6 | KEGG DRUG |
| CAS:140-63-6 | ChemIDplus |
| Citations |
|---|